C26H21F5N2O — CID 139985819
2,3,4,5,6-pentafluoro-N-[1-phenyl-2-[4-(2,4,6-trimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethenyl]aniline (PubChem CID 139985819) has the molecular formula C26H21F5N2O and a molecular weight of 472.46 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[1-phenyl-2-[4-(2,4,6-trimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethenyl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[1-phenyl-2-[4-(2,4,6-trimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 139985819 |
| Molecular Formula | C26H21F5N2O |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[1-phenyl-2-[4-(2,4,6-trimethylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethenyl]aniline |
| SMILES | Cc1cc(C)c(C2COC(C=C(Nc3c(F)c(F)c(F)c(F)c3F)c3ccccc3)=N2)c(C)c1 |
| InChI | InChI=1S/C26H21F5N2O/c1-13-9-14(2)20(15(3)10-13)18-12-34-19(32-18)11-17(16-7-5-4-6-8-16)33-26-24(30)22(28)21(27)23(29)25(26)31/h4-11,18,33H,12H2,1-3H3 |
| InChIKey | WYBWZVREFGPXSY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|