C20H17F5N2O — CID 139985832
2,3,4,5,6-pentafluoro-N-[1-phenyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)ethenyl]aniline (PubChem CID 139985832) has the molecular formula C20H17F5N2O and a molecular weight of 396.36 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[1-phenyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)ethenyl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[1-phenyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 139985832 |
| Molecular Formula | C20H17F5N2O |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[1-phenyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)ethenyl]aniline |
| SMILES | CC(C)C1COC(C=C(Nc2c(F)c(F)c(F)c(F)c2F)c2ccccc2)=N1 |
| InChI | InChI=1S/C20H17F5N2O/c1-10(2)13-9-28-14(26-13)8-12(11-6-4-3-5-7-11)27-20-18(24)16(22)15(21)17(23)19(20)25/h3-8,10,13,27H,9H2,1-2H3 |
| InChIKey | RKZLOMQOHFARSC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|