C22H24N2O3 — CID 139986030
1-[3-(1,3-benzodioxol-5-yloxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole (PubChem CID 139986030) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[3-(1,3-benzodioxol-5-yloxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole.
| Compound Name | 1-[3-(1,3-benzodioxol-5-yloxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 139986030 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-[3-(1,3-benzodioxol-5-yloxy)propyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
| SMILES | c1ccc2c3c([nH]c2c1)CCNCC3CCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H24N2O3/c1-2-6-18-17(5-1)22-15(13-23-10-9-19(22)24-18)4-3-11-25-16-7-8-20-21(12-16)27-14-26-20/h1-2,5-8,12,15,23-24H,3-4,9-11,13-14H2 |
| InChIKey | OALNDCHPLDMMHT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|