C13H19F11N2O6S3 — CID 139986929
bis(trifluoromethylsulfonyl)azanide;1-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-propylpiperidin-1-ium (PubChem CID 139986929) has the molecular formula C13H19F11N2O6S3 and a molecular weight of 604.48 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-propylpiperidin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-propylpiperidin-1-ium |
|---|---|
| PubChem CID | 139986929 |
| Molecular Formula | C13H19F11N2O6S3 |
| Molecular Weight | 604.48 g/mol |
| Exact Mass | 604.02 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-propylpiperidin-1-ium |
| SMILES | CCC[N+]1(C)CCCCC1S(=O)(=O)C(F)(F)C(F)(F)F.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H19F5NO2S.C2F6NO4S2/c1-3-7-17(2)8-5-4-6-9(17)20(18,19)11(15,16)10(12,13)14;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h9H,3-8H2,1-2H3;/q+1;-1 |
| InChIKey | CLWAZNAFKODCQI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 116.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|