C11H19F5NO2S+ — CID 139986930
1-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-propylpiperidin-1-ium (PubChem CID 139986930) has the molecular formula C11H19F5NO2S+ and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-propylpiperidin-1-ium.
| Compound Name | 1-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-propylpiperidin-1-ium |
|---|---|
| PubChem CID | 139986930 |
| Molecular Formula | C11H19F5NO2S+ |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-propylpiperidin-1-ium |
| SMILES | CCC[N+]1(C)CCCCC1S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H19F5NO2S/c1-3-7-17(2)8-5-4-6-9(17)20(18,19)11(15,16)10(12,13)14/h9H,3-8H2,1-2H3/q+1 |
| InChIKey | FPVMIASFGHBKMK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|