C7H4F9NO — CID 139987788
1,1,1,2,2,3,3,4,4-nonafluoro-5-isocyanatohexane (PubChem CID 139987788) has the molecular formula C7H4F9NO and a molecular weight of 289.10 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-5-isocyanatohexane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-5-isocyanatohexane |
|---|---|
| PubChem CID | 139987788 |
| Molecular Formula | C7H4F9NO |
| Molecular Weight | 289.10 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-5-isocyanatohexane |
| SMILES | CC(N=C=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H4F9NO/c1-3(17-2-18)4(8,9)5(10,11)6(12,13)7(14,15)16/h3H,1H3 |
| InChIKey | IPAMHWSSNJHISE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.10 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|