About hepta-1,6-dien-4-ylazanium;propane-2-sulfonate
hepta-1,6-dien-4-ylazanium;propane-2-sulfonate (PubChem CID 139988386) has the molecular formula C10H21NO3S
and a molecular weight of 235.35 g/mol. Its IUPAC name is hepta-1,6-dien-4-ylazanium;propane-2-sulfonate.
Molecular Properties
| Compound Name | hepta-1,6-dien-4-ylazanium;propane-2-sulfonate |
| PubChem CID | 139988386 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | hepta-1,6-dien-4-ylazanium;propane-2-sulfonate |
| SMILES | C=CCC([NH3+])CC=C.CC(C)S(=O)(=O)[O-] |
| InChI | InChI=1S/C7H13N.C3H8O3S/c1-3-5-7(8)6-4-2;1-3(2)7(4,5)6/h3-4,7H,1-2,5-6,8H2;3H,1-2H3,(H,4,5,6) |
| InChIKey | AEOBUZAEDIOOQS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze hepta-1,6-dien-4-ylazanium;propane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hepta-1,6-dien-4-ylazanium;propane-2-sulfonate?
The IUPAC name of hepta-1,6-dien-4-ylazanium;propane-2-sulfonate (CID 139988386) is hepta-1,6-dien-4-ylazanium;propane-2-sulfonate.
What is the SMILES notation for hepta-1,6-dien-4-ylazanium;propane-2-sulfonate?
The canonical SMILES for hepta-1,6-dien-4-ylazanium;propane-2-sulfonate is C=CCC([NH3+])CC=C.CC(C)S(=O)(=O)[O-].
What is the InChIKey of hepta-1,6-dien-4-ylazanium;propane-2-sulfonate?
The InChIKey is AEOBUZAEDIOOQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C3H8O3S/c1-3-5-7(8)6-4-2;1-3(2)7(4,5)6/h3-4,7H,1-2,5-6,8H2;3H,1-2H3,(H,4,5,6).
What are the key properties of hepta-1,6-dien-4-ylazanium;propane-2-sulfonate?
hepta-1,6-dien-4-ylazanium;propane-2-sulfonate has a molecular weight of 235.35 g/mol, XLogP of 0.69, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hepta-1,6-dien-4-ylazanium;propane-2-sulfonate is sourced from PubChem (CID 139988386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).