About butane-1-sulfonate;hepta-1,6-dien-4-ylazanium
butane-1-sulfonate;hepta-1,6-dien-4-ylazanium (PubChem CID 139988409) has the molecular formula C11H23NO3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is butane-1-sulfonate;hepta-1,6-dien-4-ylazanium.
Molecular Properties
| Compound Name | butane-1-sulfonate;hepta-1,6-dien-4-ylazanium |
| PubChem CID | 139988409 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | butane-1-sulfonate;hepta-1,6-dien-4-ylazanium |
| SMILES | C=CCC([NH3+])CC=C.CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H13N.C4H10O3S/c1-3-5-7(8)6-4-2;1-2-3-4-8(5,6)7/h3-4,7H,1-2,5-6,8H2;2-4H2,1H3,(H,5,6,7) |
| InChIKey | WLBJWRVRAZDUEI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze butane-1-sulfonate;hepta-1,6-dien-4-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1-sulfonate;hepta-1,6-dien-4-ylazanium?
The IUPAC name of butane-1-sulfonate;hepta-1,6-dien-4-ylazanium (CID 139988409) is butane-1-sulfonate;hepta-1,6-dien-4-ylazanium.
What is the SMILES notation for butane-1-sulfonate;hepta-1,6-dien-4-ylazanium?
The canonical SMILES for butane-1-sulfonate;hepta-1,6-dien-4-ylazanium is C=CCC([NH3+])CC=C.CCCCS(=O)(=O)[O-].
What is the InChIKey of butane-1-sulfonate;hepta-1,6-dien-4-ylazanium?
The InChIKey is WLBJWRVRAZDUEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C4H10O3S/c1-3-5-7(8)6-4-2;1-2-3-4-8(5,6)7/h3-4,7H,1-2,5-6,8H2;2-4H2,1H3,(H,5,6,7).
What are the key properties of butane-1-sulfonate;hepta-1,6-dien-4-ylazanium?
butane-1-sulfonate;hepta-1,6-dien-4-ylazanium has a molecular weight of 249.38 g/mol, XLogP of 1.08, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1-sulfonate;hepta-1,6-dien-4-ylazanium is sourced from PubChem (CID 139988409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).