C14H11F18NO4S — CID 139988731
ethyl 2-[[3,3,4,4,5,5,6,6,6-nonafluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)hexyl]amino]acetate (PubChem CID 139988731) has the molecular formula C14H11F18NO4S and a molecular weight of 631.28 g/mol. Its IUPAC name is ethyl 2-[[3,3,4,4,5,5,6,6,6-nonafluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)hexyl]amino]acetate.
| Compound Name | ethyl 2-[[3,3,4,4,5,5,6,6,6-nonafluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)hexyl]amino]acetate |
|---|---|
| PubChem CID | 139988731 |
| Molecular Formula | C14H11F18NO4S |
| Molecular Weight | 631.28 g/mol |
| Exact Mass | 631.01 |
| IUPAC Name | ethyl 2-[[3,3,4,4,5,5,6,6,6-nonafluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)hexyl]amino]acetate |
| SMILES | CCOC(=O)CNC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H11F18NO4S/c1-2-37-6(34)4-33-5(3-7(15,16)8(17,18)9(19,20)12(25,26)27)38(35,36)14(31,32)11(23,24)10(21,22)13(28,29)30/h5,33H,2-4H2,1H3 |
| InChIKey | XELMMYSARJFYAT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|