C12H6F14O — CID 139988827
2-ethyl-1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoroadamantan-2-ol (PubChem CID 139988827) has the molecular formula C12H6F14O and a molecular weight of 432.15 g/mol. Its IUPAC name is 2-ethyl-1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoroadamantan-2-ol.
| Compound Name | 2-ethyl-1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoroadamantan-2-ol |
|---|---|
| PubChem CID | 139988827 |
| Molecular Formula | C12H6F14O |
| Molecular Weight | 432.15 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 2-ethyl-1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoroadamantan-2-ol |
| SMILES | CCC1(O)C2(F)C(F)(F)C3(F)C(F)(F)C(F)(C2(F)F)C(F)(F)C1(F)C3(F)F |
| InChI | InChI=1S/C12H6F14O/c1-2-3(27)4(13)8(17,18)6(15)10(21,22)5(3,14)11(23,24)7(16,9(4,19)20)12(6,25)26/h27H,2H2,1H3 |
| InChIKey | BFVHQJSENOLQRR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |