C22H22N2O2 — CID 139989757
benzyl N-[(1S,2S)-2-amino-1,2-diphenylethyl]carbamate (PubChem CID 139989757) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is benzyl N-[(1S,2S)-2-amino-1,2-diphenylethyl]carbamate.
| Compound Name | benzyl N-[(1S,2S)-2-amino-1,2-diphenylethyl]carbamate |
|---|---|
| PubChem CID | 139989757 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | benzyl N-[(1S,2S)-2-amino-1,2-diphenylethyl]carbamate |
| SMILES | N[C@@H](c1ccccc1)[C@@H](NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c23-20(18-12-6-2-7-13-18)21(19-14-8-3-9-15-19)24-22(25)26-16-17-10-4-1-5-11-17/h1-15,20-21H,16,23H2,(H,24,25)/t20-,21-/m0/s1 |
| InChIKey | GYEGAELRBVFZJM-SFTDATJTSA-N |
| XLogP | 4.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |