About 1-octa-1,7-dien-3-yloxyoctane
1-octa-1,7-dien-3-yloxyoctane (PubChem CID 139990053) has the molecular formula C16H30O
and a molecular weight of 238.41 g/mol. Its IUPAC name is 1-octa-1,7-dien-3-yloxyoctane.
Molecular Properties
| Compound Name | 1-octa-1,7-dien-3-yloxyoctane |
| PubChem CID | 139990053 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 1-octa-1,7-dien-3-yloxyoctane |
| SMILES | C=CCCCC(C=C)OCCCCCCCC |
| InChI | InChI=1S/C16H30O/c1-4-7-9-10-11-13-15-17-16(6-3)14-12-8-5-2/h5-6,16H,2-4,7-15H2,1H3 |
| InChIKey | GRIVCFLFGPDJOA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-octa-1,7-dien-3-yloxyoctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octa-1,7-dien-3-yloxyoctane?
The IUPAC name of 1-octa-1,7-dien-3-yloxyoctane (CID 139990053) is 1-octa-1,7-dien-3-yloxyoctane.
What is the SMILES notation for 1-octa-1,7-dien-3-yloxyoctane?
The canonical SMILES for 1-octa-1,7-dien-3-yloxyoctane is C=CCCCC(C=C)OCCCCCCCC.
What is the InChIKey of 1-octa-1,7-dien-3-yloxyoctane?
The InChIKey is GRIVCFLFGPDJOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O/c1-4-7-9-10-11-13-15-17-16(6-3)14-12-8-5-2/h5-6,16H,2-4,7-15H2,1H3.
What are the key properties of 1-octa-1,7-dien-3-yloxyoctane?
1-octa-1,7-dien-3-yloxyoctane has a molecular weight of 238.41 g/mol, XLogP of 5.27, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octa-1,7-dien-3-yloxyoctane is sourced from PubChem (CID 139990053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).