C14H15NO2 — CID 139990746
naphthalen-1-ylmethyl N-ethylcarbamate (PubChem CID 139990746) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is naphthalen-1-ylmethyl N-ethylcarbamate.
| Compound Name | naphthalen-1-ylmethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 139990746 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | naphthalen-1-ylmethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C14H15NO2/c1-2-15-14(16)17-10-12-8-5-7-11-6-3-4-9-13(11)12/h3-9H,2,10H2,1H3,(H,15,16) |
| InChIKey | WMIUMWCERFBPQO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |