About 3-(1-ethoxyethyl)octane-1,6-diimine
3-(1-ethoxyethyl)octane-1,6-diimine (PubChem CID 139990770) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 3-(1-ethoxyethyl)octane-1,6-diimine.
Molecular Properties
| Compound Name | 3-(1-ethoxyethyl)octane-1,6-diimine |
| PubChem CID | 139990770 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 3-(1-ethoxyethyl)octane-1,6-diimine |
| SMILES | [H]/N=C/CC(CC/C(CC)=N/[H])C(C)OCC |
| InChI | InChI=1S/C12H24N2O/c1-4-12(14)7-6-11(8-9-13)10(3)15-5-2/h9-11,13-14H,4-8H2,1-3H3/b13-9+,14-12+ |
| InChIKey | DPPCFLFTSCYVBT-IHJNGOQESA-N |
| XLogP | 3.28 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-ethoxyethyl)octane-1,6-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethoxyethyl)octane-1,6-diimine?
The IUPAC name of 3-(1-ethoxyethyl)octane-1,6-diimine (CID 139990770) is 3-(1-ethoxyethyl)octane-1,6-diimine.
What is the SMILES notation for 3-(1-ethoxyethyl)octane-1,6-diimine?
The canonical SMILES for 3-(1-ethoxyethyl)octane-1,6-diimine is [H]/N=C/CC(CC/C(CC)=N/[H])C(C)OCC.
What is the InChIKey of 3-(1-ethoxyethyl)octane-1,6-diimine?
The InChIKey is DPPCFLFTSCYVBT-IHJNGOQESA-N. The full InChI is InChI=1S/C12H24N2O/c1-4-12(14)7-6-11(8-9-13)10(3)15-5-2/h9-11,13-14H,4-8H2,1-3H3/b13-9+,14-12+.
What are the key properties of 3-(1-ethoxyethyl)octane-1,6-diimine?
3-(1-ethoxyethyl)octane-1,6-diimine has a molecular weight of 212.34 g/mol, XLogP of 3.28, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethoxyethyl)octane-1,6-diimine is sourced from PubChem (CID 139990770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).