About tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite
tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite (PubChem CID 139990791) has the molecular formula C51H84N3O3P
and a molecular weight of 818.22 g/mol. Its IUPAC name is tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite.
Molecular Properties
| Compound Name | tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite |
| PubChem CID | 139990791 |
| Molecular Formula | C51H84N3O3P |
| Molecular Weight | 818.22 g/mol |
| Exact Mass | 817.63 |
| IUPAC Name | tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite |
| SMILES | CC(C)(C)c1cc(COP(OCc2cc(C(C)(C)C)c(CCN)c(C(C)(C)C)c2)OCc2cc(C(C)(C)C)c(CCN)c(C(C)(C)C)c2)cc(C(C)(C)C)c1CCN |
| InChI | InChI=1S/C51H84N3O3P/c1-46(2,3)40-25-34(26-41(47(4,5)6)37(40)19-22-52)31-55-58(56-32-35-27-42(48(7,8)9)38(20-23-53)43(28-35)49(10,11)12)57-33-36-29-44(50(13,14)15)39(21-24-54)45(30-36)51(16,17)18/h25-30H,19-24,31-33,52-54H2,1-18H3 |
| InChIKey | PIDRKZKEXVDUMV-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 818.22 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite?
The IUPAC name of tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite (CID 139990791) is tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite.
What is the SMILES notation for tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite?
The canonical SMILES for tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite is CC(C)(C)c1cc(COP(OCc2cc(C(C)(C)C)c(CCN)c(C(C)(C)C)c2)OCc2cc(C(C)(C)C)c(CCN)c(C(C)(C)C)c2)cc(C(C)(C)C)c1CCN.
What is the InChIKey of tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite?
The InChIKey is PIDRKZKEXVDUMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C51H84N3O3P/c1-46(2,3)40-25-34(26-41(47(4,5)6)37(40)19-22-52)31-55-58(56-32-35-27-42(48(7,8)9)38(20-23-53)43(28-35)49(10,11)12)57-33-36-29-44(50(13,14)15)39(21-24-54)45(30-36)51(16,17)18/h25-30H,19-24,31-33,52-54H2,1-18H3.
What are the key properties of tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite?
tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite has a molecular weight of 818.22 g/mol, XLogP of 12.15, 15 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris[[4-(2-aminoethyl)-3,5-ditert-butylphenyl]methyl] phosphite is sourced from PubChem (CID 139990791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).