C25H19F2N7O5 — CID 139990831
2-[[4-(2,4-difluorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]carbamoyl]benzoic acid (PubChem CID 139990831) has the molecular formula C25H19F2N7O5 and a molecular weight of 535.47 g/mol. Its IUPAC name is 2-[[4-(2,4-difluorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-(2,4-difluorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 139990831 |
| Molecular Formula | C25H19F2N7O5 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 2-[[4-(2,4-difluorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-5-yl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1cnc(NCCNc2ccc([N+](=O)[O-])cn2)nc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C25H19F2N7O5/c26-14-5-7-18(19(27)11-14)22-20(32-23(35)16-3-1-2-4-17(16)24(36)37)13-31-25(33-22)29-10-9-28-21-8-6-15(12-30-21)34(38)39/h1-8,11-13H,9-10H2,(H,28,30)(H,32,35)(H,36,37)(H,29,31,33) |
| InChIKey | XTWRWNRFJNIRFG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 172.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|