C31H22Cl2F6N4O4 — CID 139991004
[3-(3,4-dichlorophenyl)-2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-1-(2,2,2-trifluoroacetyl)oxyindol-4-yl] 2,2,2-trifluoroacetate (PubChem CID 139991004) has the molecular formula C31H22Cl2F6N4O4 and a molecular weight of 699.44 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)-2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-1-(2,2,2-trifluoroacetyl)oxyindol-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-(3,4-dichlorophenyl)-2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-1-(2,2,2-trifluoroacetyl)oxyindol-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139991004 |
| Molecular Formula | C31H22Cl2F6N4O4 |
| Molecular Weight | 699.44 g/mol |
| Exact Mass | 698.09 |
| IUPAC Name | [3-(3,4-dichlorophenyl)-2-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]-1-(2,2,2-trifluoroacetyl)oxyindol-4-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cccc2c1c(-c1ccc(Cl)c(Cl)c1)c(CN1CCN(c3cccc4[nH]ccc34)CC1)n2OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C31H22Cl2F6N4O4/c32-19-8-7-17(15-20(19)33)26-24(16-41-11-13-42(14-12-41)22-4-1-3-21-18(22)9-10-40-21)43(47-29(45)31(37,38)39)23-5-2-6-25(27(23)26)46-28(44)30(34,35)36/h1-10,15,40H,11-14,16H2 |
| InChIKey | AZRHUBNRDNAJPO-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.44 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|