C11H17N — CID 139991219
1,2,3,5,6-pentamethylazepine (PubChem CID 139991219) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 1,2,3,5,6-pentamethylazepine.
| Compound Name | 1,2,3,5,6-pentamethylazepine |
|---|---|
| PubChem CID | 139991219 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1,2,3,5,6-pentamethylazepine |
| SMILES | CC1=CC(C)=C(C)N(C)C=C1C |
| InChI | InChI=1S/C11H17N/c1-8-6-9(2)11(4)12(5)7-10(8)3/h6-7H,1-5H3 |
| InChIKey | YFKYODUXEXOKPJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |