About 1,2,3,7-tetramethylazepine
1,2,3,7-tetramethylazepine (PubChem CID 139991248) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 1,2,3,7-tetramethylazepine.
Molecular Properties
| Compound Name | 1,2,3,7-tetramethylazepine |
| PubChem CID | 139991248 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1,2,3,7-tetramethylazepine |
| SMILES | CC1=CC=CC(C)=C(C)N1C |
| InChI | InChI=1S/C10H15N/c1-8-6-5-7-9(2)11(4)10(8)3/h5-7H,1-4H3 |
| InChIKey | AIOFWKKROJZZPL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2,3,7-tetramethylazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,7-tetramethylazepine?
The IUPAC name of 1,2,3,7-tetramethylazepine (CID 139991248) is 1,2,3,7-tetramethylazepine.
What is the SMILES notation for 1,2,3,7-tetramethylazepine?
The canonical SMILES for 1,2,3,7-tetramethylazepine is CC1=CC=CC(C)=C(C)N1C.
What is the InChIKey of 1,2,3,7-tetramethylazepine?
The InChIKey is AIOFWKKROJZZPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-8-6-5-7-9(2)11(4)10(8)3/h5-7H,1-4H3.
What are the key properties of 1,2,3,7-tetramethylazepine?
1,2,3,7-tetramethylazepine has a molecular weight of 149.24 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,7-tetramethylazepine is sourced from PubChem (CID 139991248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).