C26H27O3P — CID 139991504
6-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)oxy]benzo[c][2,1]benzoxaphosphinine (PubChem CID 139991504) has the molecular formula C26H27O3P and a molecular weight of 418.47 g/mol. Its IUPAC name is 6-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)oxy]benzo[c][2,1]benzoxaphosphinine.
| Compound Name | 6-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)oxy]benzo[c][2,1]benzoxaphosphinine |
|---|---|
| PubChem CID | 139991504 |
| Molecular Formula | C26H27O3P |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 6-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)oxy]benzo[c][2,1]benzoxaphosphinine |
| SMILES | Cc1c(C)c2c(c(C)c1OP1Oc3ccccc3-c3ccccc31)CCC(C)(C)O2 |
| InChI | InChI=1S/C26H27O3P/c1-16-17(2)25-19(14-15-26(4,5)27-25)18(3)24(16)29-30-23-13-9-7-11-21(23)20-10-6-8-12-22(20)28-30/h6-13H,14-15H2,1-5H3 |
| InChIKey | SQNQNTKLUQUJGF-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|