About 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene
1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene (PubChem CID 139991706) has the molecular formula C20H26FIO3S
and a molecular weight of 492.39 g/mol. Its IUPAC name is 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene.
Molecular Properties
| Compound Name | 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene |
| PubChem CID | 139991706 |
| Molecular Formula | C20H26FIO3S |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene |
| SMILES | CC(C)(C)c1ccc(I(OS(=O)(=O)F)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H26FIO3S/c1-19(2,3)15-7-11-17(12-8-15)22(25-26(21,23)24)18-13-9-16(10-14-18)20(4,5)6/h7-14H,1-6H3 |
| InChIKey | YMDBOOBUMKRCMK-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene?
The IUPAC name of 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene (CID 139991706) is 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene.
What is the SMILES notation for 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene?
The canonical SMILES for 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene is CC(C)(C)c1ccc(I(OS(=O)(=O)F)c2ccc(C(C)(C)C)cc2)cc1.
What is the InChIKey of 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene?
The InChIKey is YMDBOOBUMKRCMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26FIO3S/c1-19(2,3)15-7-11-17(12-8-15)22(25-26(21,23)24)18-13-9-16(10-14-18)20(4,5)6/h7-14H,1-6H3.
What are the key properties of 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene?
1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene has a molecular weight of 492.39 g/mol, XLogP of 5.97, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-[(4-tert-butylphenyl)-fluorosulfonyloxy-λ3-iodanyl]benzene is sourced from PubChem (CID 139991706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).