C29H34FN9O — CID 139991781
1-cyano-1-[(1R,2R)-2-[(3S)-3-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]cyclohexyl]-2-[4-(1-methyltetrazol-5-yl)phenyl]guanidine (PubChem CID 139991781) has the molecular formula C29H34FN9O and a molecular weight of 543.65 g/mol. Its IUPAC name is 1-cyano-1-[(1R,2R)-2-[(3S)-3-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]cyclohexyl]-2-[4-(1-methyltetrazol-5-yl)phenyl]guanidine.
| Compound Name | 1-cyano-1-[(1R,2R)-2-[(3S)-3-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]cyclohexyl]-2-[4-(1-methyltetrazol-5-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 139991781 |
| Molecular Formula | C29H34FN9O |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | 1-cyano-1-[(1R,2R)-2-[(3S)-3-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]cyclohexyl]-2-[4-(1-methyltetrazol-5-yl)phenyl]guanidine |
| SMILES | Cn1nnnc1-c1ccc(/N=C(\N)N(C#N)[C@@H]2CCCC[C@H]2C(=O)N2CCC[C@@H](Cc3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C29H34FN9O/c1-37-27(34-35-36-37)22-10-14-24(15-11-22)33-29(32)39(19-31)26-7-3-2-6-25(26)28(40)38-16-4-5-21(18-38)17-20-8-12-23(30)13-9-20/h8-15,21,25-26H,2-7,16-18H2,1H3,(H2,32,33)/t21-,25+,26+/m0/s1 |
| InChIKey | MYQJVEMBHGKWBR-RMUDUWAUSA-N |
| XLogP | 3.79 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|