C25H30FNO6 — CID 139993044
1-(4-fluorophenyl)-3-[4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]phenyl]azetidin-2-one (PubChem CID 139993044) has the molecular formula C25H30FNO6 and a molecular weight of 459.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]phenyl]azetidin-2-one.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 139993044 |
| Molecular Formula | C25H30FNO6 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]phenyl]azetidin-2-one |
| SMILES | O=C1C(c2ccc(CCCC[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2)CN1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H30FNO6/c26-17-9-11-18(12-10-17)27-13-19(25(27)32)16-7-5-15(6-8-16)3-1-2-4-20-22(29)24(31)23(30)21(14-28)33-20/h5-12,19-24,28-31H,1-4,13-14H2/t19?,20-,21+,22-,23+,24+/m0/s1 |
| InChIKey | NKILCPVLKOSFPW-OXTAILBZSA-N |
| XLogP | 1.51 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|