C24H26FNO6 — CID 139993050
1-(4-fluorophenyl)-3-[4-[1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enyl]phenyl]azetidin-2-one (PubChem CID 139993050) has the molecular formula C24H26FNO6 and a molecular weight of 443.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enyl]phenyl]azetidin-2-one.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enyl]phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 139993050 |
| Molecular Formula | C24H26FNO6 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]prop-2-enyl]phenyl]azetidin-2-one |
| SMILES | C=CC(c1ccc(C2CN(c3ccc(F)cc3)C2=O)cc1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H26FNO6/c1-2-17(23-22(30)21(29)20(28)19(12-27)32-23)13-3-5-14(6-4-13)18-11-26(24(18)31)16-9-7-15(25)8-10-16/h2-10,17-23,27-30H,1,11-12H2/t17?,18?,19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | PKWAHRZCZLOZQF-VUFYAUDZSA-N |
| XLogP | 1.07 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|