C26H32FNO6 — CID 139993052
1-(4-fluorophenyl)-3-[4-[5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentyl]phenyl]azetidin-2-one (PubChem CID 139993052) has the molecular formula C26H32FNO6 and a molecular weight of 473.54 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentyl]phenyl]azetidin-2-one.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentyl]phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 139993052 |
| Molecular Formula | C26H32FNO6 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pentyl]phenyl]azetidin-2-one |
| SMILES | O=C1C(c2ccc(CCCCC[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2)CN1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H32FNO6/c27-18-10-12-19(13-11-18)28-14-20(26(28)33)17-8-6-16(7-9-17)4-2-1-3-5-21-23(30)25(32)24(31)22(15-29)34-21/h6-13,20-25,29-32H,1-5,14-15H2/t20?,21-,22+,23-,24+,25+/m0/s1 |
| InChIKey | YWCCNCXIVROSMN-DETLCITQSA-N |
| XLogP | 1.90 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|