C25H30FNO7 — CID 139993055
1-(4-fluorophenyl)-3-[4-[3-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxy]propyl]phenyl]azetidin-2-one (PubChem CID 139993055) has the molecular formula C25H30FNO7 and a molecular weight of 475.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[3-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxy]propyl]phenyl]azetidin-2-one.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[3-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxy]propyl]phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 139993055 |
| Molecular Formula | C25H30FNO7 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[3-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxy]propyl]phenyl]azetidin-2-one |
| SMILES | O=C1C(c2ccc(CCCOC[C@@H]3O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]3O)cc2)CN1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H30FNO7/c26-17-7-9-18(10-8-17)27-12-19(25(27)32)16-5-3-15(4-6-16)2-1-11-33-14-21-23(30)24(31)22(29)20(13-28)34-21/h3-10,19-24,28-31H,1-2,11-14H2/t19?,20-,21+,22-,23+,24-/m1/s1 |
| InChIKey | YQWRLOJFTDWAMB-QXSLLXTNSA-N |
| XLogP | 0.75 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|