C25H28FNO6 — CID 139993057
1-(4-fluorophenyl)-3-[4-[1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-enyl]phenyl]azetidin-2-one (PubChem CID 139993057) has the molecular formula C25H28FNO6 and a molecular weight of 457.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-enyl]phenyl]azetidin-2-one.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-enyl]phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 139993057 |
| Molecular Formula | C25H28FNO6 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-enyl]phenyl]azetidin-2-one |
| SMILES | C=CCC(c1ccc(C2CN(c3ccc(F)cc3)C2=O)cc1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H28FNO6/c1-2-3-18(24-23(31)22(30)21(29)20(13-28)33-24)14-4-6-15(7-5-14)19-12-27(25(19)32)17-10-8-16(26)9-11-17/h2,4-11,18-24,28-31H,1,3,12-13H2/t18?,19?,20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | VDYHKWRNSAKDMK-PUCHYLIASA-N |
| XLogP | 1.46 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|