C44H38N4O10S — CID 139993120
[(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 3-(benzhydrylsulfanyloxymethyl)-2-(4-methoxyphenyl)-5-nitrobenzoate (PubChem CID 139993120) has the molecular formula C44H38N4O10S and a molecular weight of 814.87 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 3-(benzhydrylsulfanyloxymethyl)-2-(4-methoxyphenyl)-5-nitrobenzoate.
| Compound Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 3-(benzhydrylsulfanyloxymethyl)-2-(4-methoxyphenyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 139993120 |
| Molecular Formula | C44H38N4O10S |
| Molecular Weight | 814.87 g/mol |
| Exact Mass | 814.23 |
| IUPAC Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl 3-(benzhydrylsulfanyloxymethyl)-2-(4-methoxyphenyl)-5-nitrobenzoate |
| SMILES | COc1ccc(-c2c(COSC(c3ccccc3)c3ccccc3)cc([N+](=O)[O-])cc2C(=O)OC[C@H]2O[C@@H](n3ccc(NC(=O)c4ccccc4)nc3=O)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C44H38N4O10S/c1-55-34-19-17-28(18-20-34)40-32(26-57-59-41(29-11-5-2-6-12-29)30-13-7-3-8-14-30)23-33(48(53)54)24-35(40)43(51)56-27-37-36(49)25-39(58-37)47-22-21-38(46-44(47)52)45-42(50)31-15-9-4-10-16-31/h2-24,36-37,39,41,49H,25-27H2,1H3,(H,45,46,50,52)/t36-,37+,39+/m0/s1 |
| InChIKey | XMLNFGPLEZBZOS-OPWUGURCSA-N |
| XLogP | 7.54 |
| TPSA | 181.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.87 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|