C43H71O41P5 — CID 139993738
[acetyloxymethoxy-[(1R,2S,3S,4S,5R,6S)-3,4,5,6-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-3-butoxy-2-propylcyclohexyl]oxyphosphoryl]oxymethyl acetate (PubChem CID 139993738) has the molecular formula C43H71O41P5 and a molecular weight of 1398.87 g/mol. Its IUPAC name is [acetyloxymethoxy-[(1R,2S,3S,4S,5R,6S)-3,4,5,6-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-3-butoxy-2-propylcyclohexyl]oxyphosphoryl]oxymethyl acetate.
| Compound Name | [acetyloxymethoxy-[(1R,2S,3S,4S,5R,6S)-3,4,5,6-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-3-butoxy-2-propylcyclohexyl]oxyphosphoryl]oxymethyl acetate |
|---|---|
| PubChem CID | 139993738 |
| Molecular Formula | C43H71O41P5 |
| Molecular Weight | 1398.87 g/mol |
| Exact Mass | 1398.22 |
| IUPAC Name | [acetyloxymethoxy-[(1R,2S,3S,4S,5R,6S)-3,4,5,6-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-3-butoxy-2-propylcyclohexyl]oxyphosphoryl]oxymethyl acetate |
| SMILES | CCCCO[C@@]1(OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)C(OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@@H]1CCC |
| InChI | InChI=1S/C43H71O41P5/c1-13-15-17-69-43(84-89(58,78-26-67-36(11)52)79-27-68-37(12)53)38(16-14-2)39(80-85(54,70-18-59-28(3)44)71-19-60-29(4)45)40(81-86(55,72-20-61-30(5)46)73-21-62-31(6)47)41(82-87(56,74-22-63-32(7)48)75-23-64-33(8)49)42(43)83-88(57,76-24-65-34(9)50)77-25-66-35(10)51/h38-42H,13-27H2,1-12H3/t38-,39+,40-,41?,42-,43-/m0/s1 |
| InChIKey | IZWKVIILLKCBDZ-GVBQNKCMSA-N |
| XLogP | 5.40 |
| TPSA | 496.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 41 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 89 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1398.87 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 41 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|