C16H40O34P8 — CID 139993744
[2-butoxy-5,6-bis[[hydroxy(phosphonoperoxy)phosphoryl]oxy]-2-[1-[hydroxy(phosphonoperoxy)phosphoryl]oxypropyl]-1-propoxycyclohexyl] phosphonooxy hydrogen phosphate (PubChem CID 139993744) has the molecular formula C16H40O34P8 and a molecular weight of 1024.25 g/mol. Its IUPAC name is [2-butoxy-5,6-bis[[hydroxy(phosphonoperoxy)phosphoryl]oxy]-2-[1-[hydroxy(phosphonoperoxy)phosphoryl]oxypropyl]-1-propoxycyclohexyl] phosphonooxy hydrogen phosphate.
| Compound Name | [2-butoxy-5,6-bis[[hydroxy(phosphonoperoxy)phosphoryl]oxy]-2-[1-[hydroxy(phosphonoperoxy)phosphoryl]oxypropyl]-1-propoxycyclohexyl] phosphonooxy hydrogen phosphate |
|---|---|
| PubChem CID | 139993744 |
| Molecular Formula | C16H40O34P8 |
| Molecular Weight | 1024.25 g/mol |
| Exact Mass | 1023.93 |
| IUPAC Name | [2-butoxy-5,6-bis[[hydroxy(phosphonoperoxy)phosphoryl]oxy]-2-[1-[hydroxy(phosphonoperoxy)phosphoryl]oxypropyl]-1-propoxycyclohexyl] phosphonooxy hydrogen phosphate |
| SMILES | CCCCOC1(C(CC)OP(=O)(O)OOP(=O)(O)O)CCC(OP(=O)(O)OOP(=O)(O)O)C(OP(=O)(O)OOP(=O)(O)O)C1(OCCC)OP(=O)(O)OOP(=O)(O)O |
| InChI | InChI=1S/C16H40O34P8/c1-4-7-11-37-15(13(6-3)40-56(31,32)48-44-52(20,21)22)9-8-12(39-55(29,30)47-43-51(17,18)19)14(41-57(33,34)49-45-53(23,24)25)16(15,38-10-5-2)42-58(35,36)50-46-54(26,27)28/h12-14H,4-11H2,1-3H3,(H,29,30)(H,31,32)(H,33,34)(H,35,36)(H2,17,18,19)(H2,20,21,22)(H2,23,24,25)(H2,26,27,28) |
| InChIKey | DLFDTMBWYHBGLV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 508.54 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|