C13H31O21P5 — CID 139993747
[(1S,2S,3S,4R,5S,6R)-2-butoxy-3,4,5,6-tetraphosphonooxy-4-propylcyclohexyl] dihydrogen phosphate (PubChem CID 139993747) has the molecular formula C13H31O21P5 and a molecular weight of 678.24 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5S,6R)-2-butoxy-3,4,5,6-tetraphosphonooxy-4-propylcyclohexyl] dihydrogen phosphate.
| Compound Name | [(1S,2S,3S,4R,5S,6R)-2-butoxy-3,4,5,6-tetraphosphonooxy-4-propylcyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 139993747 |
| Molecular Formula | C13H31O21P5 |
| Molecular Weight | 678.24 g/mol |
| Exact Mass | 678.00 |
| IUPAC Name | [(1S,2S,3S,4R,5S,6R)-2-butoxy-3,4,5,6-tetraphosphonooxy-4-propylcyclohexyl] dihydrogen phosphate |
| SMILES | CCCCO[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@](CCC)(OP(=O)(O)O)[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C13H31O21P5/c1-3-5-7-29-9-8(30-35(14,15)16)10(31-36(17,18)19)12(33-38(23,24)25)13(6-4-2,34-39(26,27)28)11(9)32-37(20,21)22/h8-12H,3-7H2,1-2H3,(H2,14,15,16)(H2,17,18,19)(H2,20,21,22)(H2,23,24,25)(H2,26,27,28)/t8-,9-,10+,11-,12-,13+/m0/s1 |
| InChIKey | YSSUZAVMJGKLKX-DIURFFJMSA-N |
| XLogP | -0.25 |
| TPSA | 343.03 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|