C24H23N7O4S — CID 139995036
2-[5-[(3,4-dimethoxyphenyl)methylamino]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-N,N-dimethyl-1,3-thiazole-4-carboxamide (PubChem CID 139995036) has the molecular formula C24H23N7O4S and a molecular weight of 505.56 g/mol. Its IUPAC name is 2-[5-[(3,4-dimethoxyphenyl)methylamino]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-N,N-dimethyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[5-[(3,4-dimethoxyphenyl)methylamino]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-N,N-dimethyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 139995036 |
| Molecular Formula | C24H23N7O4S |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 2-[5-[(3,4-dimethoxyphenyl)methylamino]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-N,N-dimethyl-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(CNc2ncc(-c3nc(C(=O)N(C)C)cs3)c3nc(-c4ccco4)nn23)cc1OC |
| InChI | InChI=1S/C24H23N7O4S/c1-30(2)23(32)16-13-36-22(27-16)15-12-26-24(25-11-14-7-8-17(33-3)19(10-14)34-4)31-21(15)28-20(29-31)18-6-5-9-35-18/h5-10,12-13H,11H2,1-4H3,(H,25,26) |
| InChIKey | RVRPTLGLFLYAGK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |