C17H17N5O2 — CID 139995584
2-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]phenyl]phenol (PubChem CID 139995584) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 2-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]phenyl]phenol.
| Compound Name | 2-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]phenyl]phenol |
|---|---|
| PubChem CID | 139995584 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]phenyl]phenol |
| SMILES | Nc1nc(N)nc(CCOc2ccccc2-c2ccccc2O)n1 |
| InChI | InChI=1S/C17H17N5O2/c18-16-20-15(21-17(19)22-16)9-10-24-14-8-4-2-6-12(14)11-5-1-3-7-13(11)23/h1-8,23H,9-10H2,(H4,18,19,20,21,22) |
| InChIKey | ACWFVTHBZGSUSG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |