C9H11BrF4O — CID 139995600
6-(2-bromo-1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptan-2-ol (PubChem CID 139995600) has the molecular formula C9H11BrF4O and a molecular weight of 291.08 g/mol. Its IUPAC name is 6-(2-bromo-1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptan-2-ol.
| Compound Name | 6-(2-bromo-1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 139995600 |
| Molecular Formula | C9H11BrF4O |
| Molecular Weight | 291.08 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 6-(2-bromo-1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptan-2-ol |
| SMILES | OC1CC2CC1C(C(F)(F)C(F)(F)Br)C2 |
| InChI | InChI=1S/C9H11BrF4O/c10-9(13,14)8(11,12)6-2-4-1-5(6)7(15)3-4/h4-7,15H,1-3H2 |
| InChIKey | DRAOTYZRLYBBOA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.08 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|