C9H9F4NaO4S — CID 139995602
sodium 1,1,2,2-tetrafluoro-2-(5-oxo-2-bicyclo[2.2.1]heptanyl)ethanesulfonate (PubChem CID 139995602) has the molecular formula C9H9F4NaO4S and a molecular weight of 312.22 g/mol. Its IUPAC name is sodium 1,1,2,2-tetrafluoro-2-(5-oxo-2-bicyclo[2.2.1]heptanyl)ethanesulfonate.
| Compound Name | sodium 1,1,2,2-tetrafluoro-2-(5-oxo-2-bicyclo[2.2.1]heptanyl)ethanesulfonate |
|---|---|
| PubChem CID | 139995602 |
| Molecular Formula | C9H9F4NaO4S |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | sodium 1,1,2,2-tetrafluoro-2-(5-oxo-2-bicyclo[2.2.1]heptanyl)ethanesulfonate |
| SMILES | O=C1CC2CC1CC2C(F)(F)C(F)(F)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H10F4O4S.Na/c10-8(11,9(12,13)18(15,16)17)6-2-5-1-4(6)3-7(5)14;/h4-6H,1-3H2,(H,15,16,17);/q;+1/p-1 |
| InChIKey | RLKNQOFKVSWIFV-UHFFFAOYSA-M |
| XLogP | -1.62 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|