About ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane
ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane (PubChem CID 139996228) has the molecular formula C21H31P
and a molecular weight of 314.45 g/mol. Its IUPAC name is ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane.
Molecular Properties
| Compound Name | ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane |
| PubChem CID | 139996228 |
| Molecular Formula | C21H31P |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane |
| SMILES | CC1=CC(C)=C(c2ccccc2P(C(C)(C)C)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H31P/c1-15-13-16(2)18(14-15)17-11-9-10-12-19(17)22(20(3,4)5)21(6,7)8/h9-13H,14H2,1-8H3 |
| InChIKey | GCCJIRCCYNDXRK-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane?
The IUPAC name of ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane (CID 139996228) is ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane.
What is the SMILES notation for ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane?
The canonical SMILES for ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane is CC1=CC(C)=C(c2ccccc2P(C(C)(C)C)C(C)(C)C)C1.
What is the InChIKey of ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane?
The InChIKey is GCCJIRCCYNDXRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31P/c1-15-13-16(2)18(14-15)17-11-9-10-12-19(17)22(20(3,4)5)21(6,7)8/h9-13H,14H2,1-8H3.
What are the key properties of ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane?
ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane has a molecular weight of 314.45 g/mol, XLogP of 6.51, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl-[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]phosphane is sourced from PubChem (CID 139996228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).