C29H26F4O5S2 — CID 139997911
[bis(4-ethoxyphenyl)-(4-fluorophenyl)-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 139997911) has the molecular formula C29H26F4O5S2 and a molecular weight of 594.65 g/mol. Its IUPAC name is [bis(4-ethoxyphenyl)-(4-fluorophenyl)-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [bis(4-ethoxyphenyl)-(4-fluorophenyl)-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 139997911 |
| Molecular Formula | C29H26F4O5S2 |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | [bis(4-ethoxyphenyl)-(4-fluorophenyl)-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | CCOc1ccc(S(OS(=O)(=O)c2ccc(C(F)(F)F)cc2)(c2ccc(F)cc2)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C29H26F4O5S2/c1-3-36-23-9-17-26(18-10-23)39(25-15-7-22(30)8-16-25,27-19-11-24(12-20-27)37-4-2)38-40(34,35)28-13-5-21(6-14-28)29(31,32)33/h5-20H,3-4H2,1-2H3 |
| InChIKey | GBJUKWMLDBFQQP-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |