C26H29ClN8O3 — CID 139997986
5-[(1-aminocyclohexyl)amino]-2-(3-chlorophenyl)-7-(3,5-dimethoxyanilino)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxamide (PubChem CID 139997986) has the molecular formula C26H29ClN8O3 and a molecular weight of 537.02 g/mol. Its IUPAC name is 5-[(1-aminocyclohexyl)amino]-2-(3-chlorophenyl)-7-(3,5-dimethoxyanilino)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxamide.
| Compound Name | 5-[(1-aminocyclohexyl)amino]-2-(3-chlorophenyl)-7-(3,5-dimethoxyanilino)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 139997986 |
| Molecular Formula | C26H29ClN8O3 |
| Molecular Weight | 537.02 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 5-[(1-aminocyclohexyl)amino]-2-(3-chlorophenyl)-7-(3,5-dimethoxyanilino)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxamide |
| SMILES | COc1cc(Nc2nc(NC3(N)CCCCC3)n3nc(-c4cccc(Cl)c4)nc3c2C(N)=O)cc(OC)c1 |
| InChI | InChI=1S/C26H29ClN8O3/c1-37-18-12-17(13-19(14-18)38-2)30-23-20(21(28)36)24-31-22(15-7-6-8-16(27)11-15)34-35(24)25(32-23)33-26(29)9-4-3-5-10-26/h6-8,11-14,30H,3-5,9-10,29H2,1-2H3,(H2,28,36)(H,32,33) |
| InChIKey | CGSMHPSZMODBKW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 154.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.02 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|