4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate

C13H20O2S — CID 139998354

IUPAC4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate
SMILESCC(C)CCCOC(=O)C1CC2C=CC1S2
InChIInChI=1S/C13H20O2S/c1-9(2)4-3-7-15-13(14)11-8-10-5-6-12(11)16-10/h5-6,9-12H,3-4,7-8H2,1-2H3
InChIKeyLATMWQAWPLPEGT-UHFFFAOYSA-N
MW240.37 g/mol
LogP3.03
Rot. Bonds5

About 4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate

4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 139998354) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate.

Molecular Properties

Compound Name4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate
PubChem CID139998354
Molecular FormulaC13H20O2S
Molecular Weight240.37 g/mol
Exact Mass240.12
IUPAC Name4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate
SMILESCC(C)CCCOC(=O)C1CC2C=CC1S2
InChIInChI=1S/C13H20O2S/c1-9(2)4-3-7-15-13(14)11-8-10-5-6-12(11)16-10/h5-6,9-12H,3-4,7-8H2,1-2H3
InChIKeyLATMWQAWPLPEGT-UHFFFAOYSA-N
XLogP3.03
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.37
LogP ≤ 53.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of 4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 139998354) is 4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for 4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for 4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate is CC(C)CCCOC(=O)C1CC2C=CC1S2.
What is the InChIKey of 4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is LATMWQAWPLPEGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2S/c1-9(2)4-3-7-15-13(14)11-8-10-5-6-12(11)16-10/h5-6,9-12H,3-4,7-8H2,1-2H3.
What are the key properties of 4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate?
4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 240.37 g/mol, XLogP of 3.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentyl 7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 139998354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).