About 4-ethyl-1,6-diiminoheptan-3-ol
4-ethyl-1,6-diiminoheptan-3-ol (PubChem CID 139998897) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 4-ethyl-1,6-diiminoheptan-3-ol.
Molecular Properties
| Compound Name | 4-ethyl-1,6-diiminoheptan-3-ol |
| PubChem CID | 139998897 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 4-ethyl-1,6-diiminoheptan-3-ol |
| SMILES | [H]/N=C/CC(O)C(CC)C/C(C)=N/[H] |
| InChI | InChI=1S/C9H18N2O/c1-3-8(6-7(2)11)9(12)4-5-10/h5,8-12H,3-4,6H2,1-2H3/b10-5+,11-7+ |
| InChIKey | BTIFAZBDXRGENG-JRNXONEVSA-N |
| XLogP | 1.84 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-1,6-diiminoheptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,6-diiminoheptan-3-ol?
The IUPAC name of 4-ethyl-1,6-diiminoheptan-3-ol (CID 139998897) is 4-ethyl-1,6-diiminoheptan-3-ol.
What is the SMILES notation for 4-ethyl-1,6-diiminoheptan-3-ol?
The canonical SMILES for 4-ethyl-1,6-diiminoheptan-3-ol is [H]/N=C/CC(O)C(CC)C/C(C)=N/[H].
What is the InChIKey of 4-ethyl-1,6-diiminoheptan-3-ol?
The InChIKey is BTIFAZBDXRGENG-JRNXONEVSA-N. The full InChI is InChI=1S/C9H18N2O/c1-3-8(6-7(2)11)9(12)4-5-10/h5,8-12H,3-4,6H2,1-2H3/b10-5+,11-7+.
What are the key properties of 4-ethyl-1,6-diiminoheptan-3-ol?
4-ethyl-1,6-diiminoheptan-3-ol has a molecular weight of 170.26 g/mol, XLogP of 1.84, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,6-diiminoheptan-3-ol is sourced from PubChem (CID 139998897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).