C24H33N5O2 — CID 139999018
2-[4-[4-[3-(dimethylamino)propyl]piperazine-1-carbonyl]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 139999018) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-[4-[4-[3-(dimethylamino)propyl]piperazine-1-carbonyl]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 2-[4-[4-[3-(dimethylamino)propyl]piperazine-1-carbonyl]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 139999018 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 2-[4-[4-[3-(dimethylamino)propyl]piperazine-1-carbonyl]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | CN(C)CCCN1CCN(C(=O)c2ccc(N3N=CC4CC=CCC4C3=O)cc2)CC1 |
| InChI | InChI=1S/C24H33N5O2/c1-26(2)12-5-13-27-14-16-28(17-15-27)23(30)19-8-10-21(11-9-19)29-24(31)22-7-4-3-6-20(22)18-25-29/h3-4,8-11,18,20,22H,5-7,12-17H2,1-2H3 |
| InChIKey | ZDACJLKUGKUCIH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|