C39H28N2O4 — CID 139999483
2-amino-5-[4-[9-[4-(4-amino-3-hydroxyphenoxy)phenyl]-1-ethynylfluoren-9-yl]phenoxy]phenol (PubChem CID 139999483) has the molecular formula C39H28N2O4 and a molecular weight of 588.66 g/mol. Its IUPAC name is 2-amino-5-[4-[9-[4-(4-amino-3-hydroxyphenoxy)phenyl]-1-ethynylfluoren-9-yl]phenoxy]phenol.
| Compound Name | 2-amino-5-[4-[9-[4-(4-amino-3-hydroxyphenoxy)phenyl]-1-ethynylfluoren-9-yl]phenoxy]phenol |
|---|---|
| PubChem CID | 139999483 |
| Molecular Formula | C39H28N2O4 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 2-amino-5-[4-[9-[4-(4-amino-3-hydroxyphenoxy)phenyl]-1-ethynylfluoren-9-yl]phenoxy]phenol |
| SMILES | C#Cc1cccc2c1C(c1ccc(Oc3ccc(N)c(O)c3)cc1)(c1ccc(Oc3ccc(N)c(O)c3)cc1)c1ccccc1-2 |
| InChI | InChI=1S/C39H28N2O4/c1-2-24-6-5-8-32-31-7-3-4-9-33(31)39(38(24)32,25-10-14-27(15-11-25)44-29-18-20-34(40)36(42)22-29)26-12-16-28(17-13-26)45-30-19-21-35(41)37(43)23-30/h1,3-23,42-43H,40-41H2 |
| InChIKey | YYKLMFWUNWVVPB-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|