C9H16N2S — CID 139999938
1,3-bis(2-methylprop-2-enyl)thiourea (PubChem CID 139999938) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 1,3-bis(2-methylprop-2-enyl)thiourea.
| Compound Name | 1,3-bis(2-methylprop-2-enyl)thiourea |
|---|---|
| PubChem CID | 139999938 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1,3-bis(2-methylprop-2-enyl)thiourea |
| SMILES | C=C(C)CNC(=S)NCC(=C)C |
| InChI | InChI=1S/C9H16N2S/c1-7(2)5-10-9(12)11-6-8(3)4/h1,3,5-6H2,2,4H3,(H2,10,11,12) |
| InChIKey | NYIFTPOWQLPPBF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|