About 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium
9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium (PubChem CID 14000337) has the molecular formula C18H16NO2S+
and a molecular weight of 310.40 g/mol. Its IUPAC name is 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium.
Molecular Properties
| Compound Name | 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium |
| PubChem CID | 14000337 |
| Molecular Formula | C18H16NO2S+ |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium |
| SMILES | COc1cc2sc3c[n+](C)c4ccccc4c3c2cc1OC |
| InChI | InChI=1S/C18H16NO2S/c1-19-10-17-18(11-6-4-5-7-13(11)19)12-8-14(20-2)15(21-3)9-16(12)22-17/h4-10H,1-3H3/q+1 |
| InChIKey | KJXNOKCHJKGENF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium?
The IUPAC name of 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium (CID 14000337) is 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium.
What is the SMILES notation for 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium?
The canonical SMILES for 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium is COc1cc2sc3c[n+](C)c4ccccc4c3c2cc1OC.
What is the InChIKey of 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium?
The InChIKey is KJXNOKCHJKGENF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16NO2S/c1-19-10-17-18(11-6-4-5-7-13(11)19)12-8-14(20-2)15(21-3)9-16(12)22-17/h4-10H,1-3H3/q+1.
What are the key properties of 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium?
9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium has a molecular weight of 310.40 g/mol, XLogP of 4.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dimethoxy-5-methyl-[1]benzothiolo[2,3-c]quinolin-5-ium is sourced from PubChem (CID 14000337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).