About 3,5-diphenyl-4H-1,2,4-diazaphosphole
3,5-diphenyl-4H-1,2,4-diazaphosphole (PubChem CID 14000518) has the molecular formula C14H11N2P
and a molecular weight of 238.23 g/mol. Its IUPAC name is 3,5-diphenyl-4H-1,2,4-diazaphosphole.
Molecular Properties
| Compound Name | 3,5-diphenyl-4H-1,2,4-diazaphosphole |
| PubChem CID | 14000518 |
| Molecular Formula | C14H11N2P |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3,5-diphenyl-4H-1,2,4-diazaphosphole |
| SMILES | c1ccc(-c2nnc(-c3ccccc3)[pH]2)cc1 |
| InChI | InChI=1S/C14H11N2P/c1-3-7-11(8-4-1)13-15-16-14(17-13)12-9-5-2-6-10-12/h1-10,17H |
| InChIKey | JXBVBXCRGCVHGG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-diphenyl-4H-1,2,4-diazaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diphenyl-4H-1,2,4-diazaphosphole?
The IUPAC name of 3,5-diphenyl-4H-1,2,4-diazaphosphole (CID 14000518) is 3,5-diphenyl-4H-1,2,4-diazaphosphole.
What is the SMILES notation for 3,5-diphenyl-4H-1,2,4-diazaphosphole?
The canonical SMILES for 3,5-diphenyl-4H-1,2,4-diazaphosphole is c1ccc(-c2nnc(-c3ccccc3)[pH]2)cc1.
What is the InChIKey of 3,5-diphenyl-4H-1,2,4-diazaphosphole?
The InChIKey is JXBVBXCRGCVHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N2P/c1-3-7-11(8-4-1)13-15-16-14(17-13)12-9-5-2-6-10-12/h1-10,17H.
What are the key properties of 3,5-diphenyl-4H-1,2,4-diazaphosphole?
3,5-diphenyl-4H-1,2,4-diazaphosphole has a molecular weight of 238.23 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diphenyl-4H-1,2,4-diazaphosphole is sourced from PubChem (CID 14000518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).