About 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride
2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride (PubChem CID 14001273) has the molecular formula C21H25ClN2OS
and a molecular weight of 388.96 g/mol. Its IUPAC name is 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 14001273 |
| Molecular Formula | C21H25ClN2OS |
| Molecular Weight | 388.96 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride |
| SMILES | COc1c(-c2ccccc2C)c(SCCN(C)C)nc2ccccc12.Cl |
| InChI | InChI=1S/C21H24N2OS.ClH/c1-15-9-5-6-10-16(15)19-20(24-4)17-11-7-8-12-18(17)22-21(19)25-14-13-23(2)3;/h5-12H,13-14H2,1-4H3;1H |
| InChIKey | YLBABHSTPCCLLD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.96 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride?
The IUPAC name of 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride (CID 14001273) is 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride is COc1c(-c2ccccc2C)c(SCCN(C)C)nc2ccccc12.Cl.
What is the InChIKey of 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride?
The InChIKey is YLBABHSTPCCLLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2OS.ClH/c1-15-9-5-6-10-16(15)19-20(24-4)17-11-7-8-12-18(17)22-21(19)25-14-13-23(2)3;/h5-12H,13-14H2,1-4H3;1H.
What are the key properties of 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride?
2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride has a molecular weight of 388.96 g/mol, XLogP of 5.29, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methoxy-3-(2-methylphenyl)quinolin-2-yl]sulfanyl-N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 14001273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).