C19H21N3O4S2 — CID 14001293
N,N-dimethyl-2-[3-(2-methyl-1,3-thiazol-5-yl)quinolin-2-yl]sulfanylethanamine;oxalic acid (PubChem CID 14001293) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-(2-methyl-1,3-thiazol-5-yl)quinolin-2-yl]sulfanylethanamine;oxalic acid.
| Compound Name | N,N-dimethyl-2-[3-(2-methyl-1,3-thiazol-5-yl)quinolin-2-yl]sulfanylethanamine;oxalic acid |
|---|---|
| PubChem CID | 14001293 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N,N-dimethyl-2-[3-(2-methyl-1,3-thiazol-5-yl)quinolin-2-yl]sulfanylethanamine;oxalic acid |
| SMILES | Cc1ncc(-c2cc3ccccc3nc2SCCN(C)C)s1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H19N3S2.C2H2O4/c1-12-18-11-16(22-12)14-10-13-6-4-5-7-15(13)19-17(14)21-9-8-20(2)3;3-1(4)2(5)6/h4-7,10-11H,8-9H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | PAZVVEHXDKGENX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|