C16H24OSSi — CID 14001321
trans-(3R,5R)-3-(4-methylphenyl)sulfanyl-5-trimethylsilylcyclohexan-1-one (PubChem CID 14001321) has the molecular formula C16H24OSSi and a molecular weight of 292.52 g/mol. Its IUPAC name is trans-(3R,5R)-3-(4-methylphenyl)sulfanyl-5-trimethylsilylcyclohexan-1-one.
| Compound Name | trans-(3R,5R)-3-(4-methylphenyl)sulfanyl-5-trimethylsilylcyclohexan-1-one |
|---|---|
| PubChem CID | 14001321 |
| Molecular Formula | C16H24OSSi |
| Molecular Weight | 292.52 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | trans-(3R,5R)-3-(4-methylphenyl)sulfanyl-5-trimethylsilylcyclohexan-1-one |
| SMILES | Cc1ccc(S[C@@H]2CC(=O)C[C@@H]([Si](C)(C)C)C2)cc1 |
| InChI | InChI=1S/C16H24OSSi/c1-12-5-7-14(8-6-12)18-15-9-13(17)10-16(11-15)19(2,3)4/h5-8,15-16H,9-11H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | DBMNNWLCXPBYPJ-HZPDHXFCSA-N |
| XLogP | 4.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|