C23H22ClN5O4 — CID 1400189
5-[[4-(4-acetylpiperazin-1-yl)phenyl]iminomethyl]-1-(4-chlorophenyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 1400189) has the molecular formula C23H22ClN5O4 and a molecular weight of 467.91 g/mol. Its IUPAC name is 5-[[4-(4-acetylpiperazin-1-yl)phenyl]iminomethyl]-1-(4-chlorophenyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[[4-(4-acetylpiperazin-1-yl)phenyl]iminomethyl]-1-(4-chlorophenyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1400189 |
| Molecular Formula | C23H22ClN5O4 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 5-[[4-(4-acetylpiperazin-1-yl)phenyl]iminomethyl]-1-(4-chlorophenyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | CC(=O)N1CCN(c2ccc(/N=C/c3c(O)n(-c4ccc(Cl)cc4)c(=O)[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C23H22ClN5O4/c1-15(30)27-10-12-28(13-11-27)18-8-4-17(5-9-18)25-14-20-21(31)26-23(33)29(22(20)32)19-6-2-16(24)3-7-19/h2-9,14,32H,10-13H2,1H3,(H,26,31,33)/b25-14+ |
| InChIKey | QNDDFLUYZZWEKO-AFUMVMLFSA-N |
| XLogP | 2.30 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|