C11H11BrFNO — CID 14002106
2-(2-bromo-5-fluorophenyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 14002106) has the molecular formula C11H11BrFNO and a molecular weight of 272.12 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 14002106 |
| Molecular Formula | C11H11BrFNO |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2cc(F)ccc2Br)=N1 |
| InChI | InChI=1S/C11H11BrFNO/c1-11(2)6-15-10(14-11)8-5-7(13)3-4-9(8)12/h3-5H,6H2,1-2H3 |
| InChIKey | OPFDSFKGFHTTGA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |